C21H30N2O6S — CID 147333812
N-[1-(4,5-dioxo-1-oxa-6-azacycloundec-3-yl)-4-methyl-2-oxopentan-3-yl]benzenesulfonamide (PubChem CID 147333812) has the molecular formula C21H30N2O6S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[1-(4,5-dioxo-1-oxa-6-azacycloundec-3-yl)-4-methyl-2-oxopentan-3-yl]benzenesulfonamide.
| Compound Name | N-[1-(4,5-dioxo-1-oxa-6-azacycloundec-3-yl)-4-methyl-2-oxopentan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 147333812 |
| Molecular Formula | C21H30N2O6S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-[1-(4,5-dioxo-1-oxa-6-azacycloundec-3-yl)-4-methyl-2-oxopentan-3-yl]benzenesulfonamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccccc1)C(=O)CC1COCCCCCNC(=O)C1=O |
| InChI | InChI=1S/C21H30N2O6S/c1-15(2)19(23-30(27,28)17-9-5-3-6-10-17)18(24)13-16-14-29-12-8-4-7-11-22-21(26)20(16)25/h3,5-6,9-10,15-16,19,23H,4,7-8,11-14H2,1-2H3,(H,22,26) |
| InChIKey | DCDVOLKTFUYCTE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|