C16H23N3O7S — CID 22444842
N-(2-hydroxyoxolan-3-yl)-4-methyl-2-[(3-nitrophenyl)sulfonylamino]pentanamide (PubChem CID 22444842) has the molecular formula C16H23N3O7S and a molecular weight of 401.44 g/mol. Its IUPAC name is N-(2-hydroxyoxolan-3-yl)-4-methyl-2-[(3-nitrophenyl)sulfonylamino]pentanamide.
| Compound Name | N-(2-hydroxyoxolan-3-yl)-4-methyl-2-[(3-nitrophenyl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 22444842 |
| Molecular Formula | C16H23N3O7S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | N-(2-hydroxyoxolan-3-yl)-4-methyl-2-[(3-nitrophenyl)sulfonylamino]pentanamide |
| SMILES | CC(C)CC(NS(=O)(=O)c1cccc([N+](=O)[O-])c1)C(=O)NC1CCOC1O |
| InChI | InChI=1S/C16H23N3O7S/c1-10(2)8-14(15(20)17-13-6-7-26-16(13)21)18-27(24,25)12-5-3-4-11(9-12)19(22)23/h3-5,9-10,13-14,16,18,21H,6-8H2,1-2H3,(H,17,20) |
| InChIKey | XNPSZXPVBXHZRU-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|