C20H32N2O5S — CID 67698595
2-[(4-tert-butylphenyl)sulfonylamino]-N-[(3S)-2-hydroxyoxolan-3-yl]-4-methylpentanamide (PubChem CID 67698595) has the molecular formula C20H32N2O5S and a molecular weight of 412.55 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)sulfonylamino]-N-[(3S)-2-hydroxyoxolan-3-yl]-4-methylpentanamide.
| Compound Name | 2-[(4-tert-butylphenyl)sulfonylamino]-N-[(3S)-2-hydroxyoxolan-3-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 67698595 |
| Molecular Formula | C20H32N2O5S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-[(4-tert-butylphenyl)sulfonylamino]-N-[(3S)-2-hydroxyoxolan-3-yl]-4-methylpentanamide |
| SMILES | CC(C)CC(NS(=O)(=O)c1ccc(C(C)(C)C)cc1)C(=O)N[C@H]1CCOC1O |
| InChI | InChI=1S/C20H32N2O5S/c1-13(2)12-17(18(23)21-16-10-11-27-19(16)24)22-28(25,26)15-8-6-14(7-9-15)20(3,4)5/h6-9,13,16-17,19,22,24H,10-12H2,1-5H3,(H,21,23)/t16-,17?,19?/m0/s1 |
| InChIKey | AXORBXMKKLOTJJ-MUYFXNHWSA-N |
| XLogP | 1.90 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |