C7H12N2 — CID 59881778
2,3,4-trimethyl-4H-pyrimidine (PubChem CID 59881778) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 2,3,4-trimethyl-4H-pyrimidine.
| Compound Name | 2,3,4-trimethyl-4H-pyrimidine |
|---|---|
| PubChem CID | 59881778 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 2,3,4-trimethyl-4H-pyrimidine |
| SMILES | CC1=NC=CC(C)N1C |
| InChI | InChI=1S/C7H12N2/c1-6-4-5-8-7(2)9(6)3/h4-6H,1-3H3 |
| InChIKey | KGEQTJMDQIUNJQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |