C30H27FN2O4 — CID 59883072
2-[(Z)-4-fluoro-5-(4-methyl-2-oxo-5,6-diphenylmorpholin-3-yl)pent-3-enyl]isoindole-1,3-dione (PubChem CID 59883072) has the molecular formula C30H27FN2O4 and a molecular weight of 498.55 g/mol. Its IUPAC name is 2-[(Z)-4-fluoro-5-(4-methyl-2-oxo-5,6-diphenylmorpholin-3-yl)pent-3-enyl]isoindole-1,3-dione.
| Compound Name | 2-[(Z)-4-fluoro-5-(4-methyl-2-oxo-5,6-diphenylmorpholin-3-yl)pent-3-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59883072 |
| Molecular Formula | C30H27FN2O4 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 2-[(Z)-4-fluoro-5-(4-methyl-2-oxo-5,6-diphenylmorpholin-3-yl)pent-3-enyl]isoindole-1,3-dione |
| SMILES | CN1C(C/C(F)=C/CCN2C(=O)c3ccccc3C2=O)C(=O)OC(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C30H27FN2O4/c1-32-25(19-22(31)15-10-18-33-28(34)23-16-8-9-17-24(23)29(33)35)30(36)37-27(21-13-6-3-7-14-21)26(32)20-11-4-2-5-12-20/h2-9,11-17,25-27H,10,18-19H2,1H3/b22-15- |
| InChIKey | CHUIMZKAPKIRDW-JCMHNJIXSA-N |
| XLogP | 5.26 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|