C11H20N2O2 — CID 59883192
2,3-dimethyl-N-[1-(methylamino)-1-oxopropan-2-yl]pent-4-enamide (PubChem CID 59883192) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2,3-dimethyl-N-[1-(methylamino)-1-oxopropan-2-yl]pent-4-enamide.
| Compound Name | 2,3-dimethyl-N-[1-(methylamino)-1-oxopropan-2-yl]pent-4-enamide |
|---|---|
| PubChem CID | 59883192 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 2,3-dimethyl-N-[1-(methylamino)-1-oxopropan-2-yl]pent-4-enamide |
| SMILES | C=CC(C)C(C)C(=O)NC(C)C(=O)NC |
| InChI | InChI=1S/C11H20N2O2/c1-6-7(2)8(3)10(14)13-9(4)11(15)12-5/h6-9H,1H2,2-5H3,(H,12,15)(H,13,14) |
| InChIKey | UOXJEHXNZYHBQW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|