C15H19N5O — CID 59884277
(6E)-6-[(Z)-(1-hydroxy-4-propyl-2-pyridinylidene)hydrazinylidene]-3-imino-4-methylcyclohexa-1,4-dien-1-amine (PubChem CID 59884277) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is (6E)-6-[(Z)-(1-hydroxy-4-propyl-2-pyridinylidene)hydrazinylidene]-3-imino-4-methylcyclohexa-1,4-dien-1-amine.
| Compound Name | (6E)-6-[(Z)-(1-hydroxy-4-propyl-2-pyridinylidene)hydrazinylidene]-3-imino-4-methylcyclohexa-1,4-dien-1-amine |
|---|---|
| PubChem CID | 59884277 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | (6E)-6-[(Z)-(1-hydroxy-4-propyl-2-pyridinylidene)hydrazinylidene]-3-imino-4-methylcyclohexa-1,4-dien-1-amine |
| SMILES | [H]/N=C1\C=C(N)/C(=N/N=c2/cc(CCC)ccn2O)C=C1C |
| InChI | InChI=1S/C15H19N5O/c1-3-4-11-5-6-20(21)15(8-11)19-18-14-7-10(2)12(16)9-13(14)17/h5-9,16,21H,3-4,17H2,1-2H3/b16-12+,18-14+,19-15- |
| InChIKey | ZMFIFDGCYXIEEH-LZRZOBLFSA-N |
| XLogP | 1.76 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|