C11H10N2O — CID 87541817
(6E)-6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine (PubChem CID 87541817) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is (6E)-6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine.
| Compound Name | (6E)-6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 87541817 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | (6E)-6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC=C\C1=C1\C=CC=CN1O |
| InChI | InChI=1S/C11H10N2O/c12-10-6-2-1-5-9(10)11-7-3-4-8-13(11)14/h1-8,12,14H/b11-9+,12-10+ |
| InChIKey | PKFAIOMSBNXXHF-WGDLNXRISA-N |
| XLogP | 2.16 |
| TPSA | 47.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|