C20H27BN2O3 — CID 59884484
(3R)-1-[(3S,6R)-6-amino-6-benzyl-5-oxo-2,3,7,8-tetrahydro-1H-azaborolo[1,2-a]azaborinin-3-yl]-3-methylpentane-1,4-dione (PubChem CID 59884484) has the molecular formula C20H27BN2O3 and a molecular weight of 354.26 g/mol. Its IUPAC name is (3R)-1-[(3S,6R)-6-amino-6-benzyl-5-oxo-2,3,7,8-tetrahydro-1H-azaborolo[1,2-a]azaborinin-3-yl]-3-methylpentane-1,4-dione.
| Compound Name | (3R)-1-[(3S,6R)-6-amino-6-benzyl-5-oxo-2,3,7,8-tetrahydro-1H-azaborolo[1,2-a]azaborinin-3-yl]-3-methylpentane-1,4-dione |
|---|---|
| PubChem CID | 59884484 |
| Molecular Formula | C20H27BN2O3 |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (3R)-1-[(3S,6R)-6-amino-6-benzyl-5-oxo-2,3,7,8-tetrahydro-1H-azaborolo[1,2-a]azaborinin-3-yl]-3-methylpentane-1,4-dione |
| SMILES | CC(=O)[C@H](C)CC(=O)[C@@H]1CCB2CC[C@@](N)(Cc3ccccc3)C(=O)N21 |
| InChI | InChI=1S/C20H27BN2O3/c1-14(15(2)24)12-18(25)17-8-10-21-11-9-20(22,19(26)23(17)21)13-16-6-4-3-5-7-16/h3-7,14,17H,8-13,22H2,1-2H3/t14-,17+,20-/m1/s1 |
| InChIKey | DQGXYHSXVXBPID-CFLQYTFWSA-N |
| XLogP | 2.11 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|