C24H39N2S+ — CID 59887620
1-methyl-2-[3,4,6,7-tetramethyl-8-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)-5-methylsulfanylnona-3,5,7-trien-2-ylidene]pyrrolidine (PubChem CID 59887620) has the molecular formula C24H39N2S+ and a molecular weight of 387.66 g/mol. Its IUPAC name is 1-methyl-2-[3,4,6,7-tetramethyl-8-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)-5-methylsulfanylnona-3,5,7-trien-2-ylidene]pyrrolidine.
| Compound Name | 1-methyl-2-[3,4,6,7-tetramethyl-8-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)-5-methylsulfanylnona-3,5,7-trien-2-ylidene]pyrrolidine |
|---|---|
| PubChem CID | 59887620 |
| Molecular Formula | C24H39N2S+ |
| Molecular Weight | 387.66 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | 1-methyl-2-[3,4,6,7-tetramethyl-8-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)-5-methylsulfanylnona-3,5,7-trien-2-ylidene]pyrrolidine |
| SMILES | CSC(C(C)=C(C)C(C)=C1CCCN1C)=C(C)C(C)=C(C)C1=[N+](C)CCC1 |
| InChI | InChI=1S/C24H39N2S/c1-16(18(3)22-12-10-14-25(22)7)20(5)24(27-9)21(6)17(2)19(4)23-13-11-15-26(23)8/h10-15H2,1-9H3/q+1 |
| InChIKey | JGVGDRPPLUZVBH-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|