C15H23N3O5 — CID 59888484
N-[1-(furan-2-ylmethylamino)-1-oxopropan-2-yl]-N'-hydroxy-2-(2-methylpropyl)propanediamide (PubChem CID 59888484) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[1-(furan-2-ylmethylamino)-1-oxopropan-2-yl]-N'-hydroxy-2-(2-methylpropyl)propanediamide.
| Compound Name | N-[1-(furan-2-ylmethylamino)-1-oxopropan-2-yl]-N'-hydroxy-2-(2-methylpropyl)propanediamide |
|---|---|
| PubChem CID | 59888484 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-[1-(furan-2-ylmethylamino)-1-oxopropan-2-yl]-N'-hydroxy-2-(2-methylpropyl)propanediamide |
| SMILES | CC(C)CC(C(=O)NO)C(=O)NC(C)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H23N3O5/c1-9(2)7-12(15(21)18-22)14(20)17-10(3)13(19)16-8-11-5-4-6-23-11/h4-6,9-10,12,22H,7-8H2,1-3H3,(H,16,19)(H,17,20)(H,18,21) |
| InChIKey | UIAMOHRZCRSTBK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|