C27H29N5O4S — CID 59889120
ethyl 7-[4-(3-azidoazetidin-1-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-cyclopropyl-8-methoxy-4-oxoquinoline-3-carboxylate (PubChem CID 59889120) has the molecular formula C27H29N5O4S and a molecular weight of 519.63 g/mol. Its IUPAC name is ethyl 7-[4-(3-azidoazetidin-1-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-cyclopropyl-8-methoxy-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 7-[4-(3-azidoazetidin-1-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-cyclopropyl-8-methoxy-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 59889120 |
| Molecular Formula | C27H29N5O4S |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | ethyl 7-[4-(3-azidoazetidin-1-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-cyclopropyl-8-methoxy-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2)c2c(OC)c(-c3cc4c(s3)CCCC4N3CC(N=[N+]=[N-])C3)ccc2c1=O |
| InChI | InChI=1S/C27H29N5O4S/c1-3-36-27(34)20-14-32(16-7-8-16)24-18(25(20)33)10-9-17(26(24)35-2)23-11-19-21(5-4-6-22(19)37-23)31-12-15(13-31)29-30-28/h9-11,14-16,21H,3-8,12-13H2,1-2H3 |
| InChIKey | RSJGAUVAZAOVDO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 109.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|