C25H25N5O5S — CID 59889302
ethyl 7-(5-acetyl-7-azido-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)-1-cyclopropyl-8-methoxy-4-oxoquinoline-3-carboxylate (PubChem CID 59889302) has the molecular formula C25H25N5O5S and a molecular weight of 507.57 g/mol. Its IUPAC name is ethyl 7-(5-acetyl-7-azido-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)-1-cyclopropyl-8-methoxy-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 7-(5-acetyl-7-azido-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)-1-cyclopropyl-8-methoxy-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 59889302 |
| Molecular Formula | C25H25N5O5S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | ethyl 7-(5-acetyl-7-azido-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl)-1-cyclopropyl-8-methoxy-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2)c2c(OC)c(-c3cc4c(s3)C(N=[N+]=[N-])CN(C(C)=O)C4)ccc2c1=O |
| InChI | InChI=1S/C25H25N5O5S/c1-4-35-25(33)18-11-30(15-5-6-15)21-17(22(18)32)8-7-16(23(21)34-3)20-9-14-10-29(13(2)31)12-19(27-28-26)24(14)36-20/h7-9,11,15,19H,4-6,10,12H2,1-3H3 |
| InChIKey | CALKWIAYARQEQP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 126.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|