C20H26N4O2 — CID 59890318
1,1,3-trimethyl-3-[4-[4-(4-tritiooxyphenyl)piperazin-1-yl]phenyl]urea (PubChem CID 59890318) has the molecular formula C20H26N4O2 and a molecular weight of 356.46 g/mol. Its IUPAC name is 1,1,3-trimethyl-3-[4-[4-(4-tritiooxyphenyl)piperazin-1-yl]phenyl]urea.
| Compound Name | 1,1,3-trimethyl-3-[4-[4-(4-tritiooxyphenyl)piperazin-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 59890318 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 1,1,3-trimethyl-3-[4-[4-(4-tritiooxyphenyl)piperazin-1-yl]phenyl]urea |
| SMILES | [3H]Oc1ccc(N2CCN(c3ccc(N(C)C(=O)N(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H26N4O2/c1-21(2)20(26)22(3)16-4-6-17(7-5-16)23-12-14-24(15-13-23)18-8-10-19(25)11-9-18/h4-11,25H,12-15H2,1-3H3/i/hT |
| InChIKey | OUCLBHQRLMFCIC-MNYXATJNSA-N |
| XLogP | 2.84 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|