C29H61Cl2MnN5 — CID 59891298
dichloromanganese;(1R,4S,7R,10S,15R)-4,7,10-tripentyl-2,5,8,11,14-pentazabicyclo[13.4.0]nonadecane (PubChem CID 59891298) has the molecular formula C29H61Cl2MnN5 and a molecular weight of 605.69 g/mol. Its IUPAC name is dichloromanganese;(1R,4S,7R,10S,15R)-4,7,10-tripentyl-2,5,8,11,14-pentazabicyclo[13.4.0]nonadecane.
| Compound Name | dichloromanganese;(1R,4S,7R,10S,15R)-4,7,10-tripentyl-2,5,8,11,14-pentazabicyclo[13.4.0]nonadecane |
|---|---|
| PubChem CID | 59891298 |
| Molecular Formula | C29H61Cl2MnN5 |
| Molecular Weight | 605.69 g/mol |
| Exact Mass | 604.37 |
| IUPAC Name | dichloromanganese;(1R,4S,7R,10S,15R)-4,7,10-tripentyl-2,5,8,11,14-pentazabicyclo[13.4.0]nonadecane |
| SMILES | CCCCC[C@@H]1CN[C@@H](CCCCC)CN[C@@H]2CCCC[C@H]2NCCN[C@@H](CCCCC)CN1.Cl[Mn]Cl |
| InChI | InChI=1S/C29H61N5.2ClH.Mn/c1-4-7-10-15-25-22-32-26(16-11-8-5-2)23-33-27(17-12-9-6-3)24-34-29-19-14-13-18-28(29)31-21-20-30-25;;;/h25-34H,4-24H2,1-3H3;2*1H;/q;;;+2/p-2/t25-,26+,27-,28+,29+;;;/m0.../s1 |
| InChIKey | UVVVILSYEQYWDC-RNMPYLGISA-L |
| XLogP | 6.48 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.69 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|