C18H39IO3P2Si — CID 59891939
[(4S,5S)-4-[(2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpentan-2-yl]-5-methyl-1,3-dioxan-2-yl]-methyl-phosphanylphosphane (PubChem CID 59891939) has the molecular formula C18H39IO3P2Si and a molecular weight of 520.45 g/mol. Its IUPAC name is [(4S,5S)-4-[(2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpentan-2-yl]-5-methyl-1,3-dioxan-2-yl]-methyl-phosphanylphosphane.
| Compound Name | [(4S,5S)-4-[(2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpentan-2-yl]-5-methyl-1,3-dioxan-2-yl]-methyl-phosphanylphosphane |
|---|---|
| PubChem CID | 59891939 |
| Molecular Formula | C18H39IO3P2Si |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | [(4S,5S)-4-[(2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-5-iodo-4-methylpentan-2-yl]-5-methyl-1,3-dioxan-2-yl]-methyl-phosphanylphosphane |
| SMILES | C[C@H]([C@H]1OC(P(C)P)OC[C@@H]1C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CI |
| InChI | InChI=1S/C18H39IO3P2Si/c1-12(10-19)16(22-25(8,9)18(4,5)6)14(3)15-13(2)11-20-17(21-15)24(7)23/h12-17H,10-11,23H2,1-9H3/t12-,13-,14+,15-,16+,17?,24?/m0/s1 |
| InChIKey | ABFMYNYHNSTEBX-WSRKZXSUSA-N |
| XLogP | 6.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|