C19H39IO3Si — CID 135017573
tert-butyl-[(2R)-2-[(4S,5S,6R)-6-[(2R)-1-iodopropan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-dimethylsilane (PubChem CID 135017573) has the molecular formula C19H39IO3Si and a molecular weight of 470.51 g/mol. Its IUPAC name is tert-butyl-[(2R)-2-[(4S,5S,6R)-6-[(2R)-1-iodopropan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R)-2-[(4S,5S,6R)-6-[(2R)-1-iodopropan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135017573 |
| Molecular Formula | C19H39IO3Si |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | tert-butyl-[(2R)-2-[(4S,5S,6R)-6-[(2R)-1-iodopropan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-dimethylsilane |
| SMILES | C[C@H]1[C@H]([C@H](C)CO[Si](C)(C)C(C)(C)C)OC(C)(C)O[C@H]1[C@@H](C)CI |
| InChI | InChI=1S/C19H39IO3Si/c1-13(11-20)16-15(3)17(23-19(7,8)22-16)14(2)12-21-24(9,10)18(4,5)6/h13-17H,11-12H2,1-10H3/t13-,14+,15+,16-,17-/m0/s1 |
| InChIKey | FREFFNWDKDKFHL-BIVLZKPYSA-N |
| XLogP | 5.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|