C30H61IO6Si2 — CID 135069942
tert-butyl-[(2R,4S,6R)-2-[2-[(4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-6-(iodomethyl)-2-methoxy-4-methyloxan-4-yl]oxy-dimethylsilane (PubChem CID 135069942) has the molecular formula C30H61IO6Si2 and a molecular weight of 700.89 g/mol. Its IUPAC name is tert-butyl-[(2R,4S,6R)-2-[2-[(4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-6-(iodomethyl)-2-methoxy-4-methyloxan-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,4S,6R)-2-[2-[(4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-6-(iodomethyl)-2-methoxy-4-methyloxan-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 135069942 |
| Molecular Formula | C30H61IO6Si2 |
| Molecular Weight | 700.89 g/mol |
| Exact Mass | 700.31 |
| IUPAC Name | tert-butyl-[(2R,4S,6R)-2-[2-[(4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-6-(iodomethyl)-2-methoxy-4-methyloxan-4-yl]oxy-dimethylsilane |
| SMILES | CO[C@@]1(CC[C@@H]2C[C@H](CCO[Si](C)(C)C(C)(C)C)OC(C)(C)O2)C[C@@](C)(O[Si](C)(C)C(C)(C)C)C[C@H](CI)O1 |
| InChI | InChI=1S/C30H61IO6Si2/c1-26(2,3)38(11,12)33-18-16-24-19-23(34-28(7,8)35-24)15-17-30(32-10)22-29(9,20-25(21-31)36-30)37-39(13,14)27(4,5)6/h23-25H,15-22H2,1-14H3/t23-,24+,25-,29+,30-/m1/s1 |
| InChIKey | SCCKXOYKBJXZAK-UYVMBCPWSA-N |
| XLogP | 8.83 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.89 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|