C27H26N2O3 — CID 59894026
[4-[[4-(2-phenylethynyl)phenyl]carbamoyl]anilino] 2,2-dimethylbutanoate (PubChem CID 59894026) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is [4-[[4-(2-phenylethynyl)phenyl]carbamoyl]anilino] 2,2-dimethylbutanoate.
| Compound Name | [4-[[4-(2-phenylethynyl)phenyl]carbamoyl]anilino] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59894026 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [4-[[4-(2-phenylethynyl)phenyl]carbamoyl]anilino] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)ONc1ccc(C(=O)Nc2ccc(C#Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H26N2O3/c1-4-27(2,3)26(31)32-29-24-18-14-22(15-19-24)25(30)28-23-16-12-21(13-17-23)11-10-20-8-6-5-7-9-20/h5-9,12-19,29H,4H2,1-3H3,(H,28,30) |
| InChIKey | UVLCXZUNNDXTEY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|