C28H19F6NO5S — CID 59896959
(Z)-3-[3-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)quinolin-8-yl]phenyl]-2-(4-methylsulfonylphenyl)prop-2-enoic acid (PubChem CID 59896959) has the molecular formula C28H19F6NO5S and a molecular weight of 595.52 g/mol. Its IUPAC name is (Z)-3-[3-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)quinolin-8-yl]phenyl]-2-(4-methylsulfonylphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-[3-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)quinolin-8-yl]phenyl]-2-(4-methylsulfonylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 59896959 |
| Molecular Formula | C28H19F6NO5S |
| Molecular Weight | 595.52 g/mol |
| Exact Mass | 595.09 |
| IUPAC Name | (Z)-3-[3-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)quinolin-8-yl]phenyl]-2-(4-methylsulfonylphenyl)prop-2-enoic acid |
| SMILES | CS(=O)(=O)c1ccc(/C(=C/c2cccc(-c3cc(C(O)(C(F)(F)F)C(F)(F)F)cc4cccnc34)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C28H19F6NO5S/c1-41(39,40)21-9-7-17(8-10-21)23(25(36)37)13-16-4-2-5-18(12-16)22-15-20(14-19-6-3-11-35-24(19)22)26(38,27(29,30)31)28(32,33)34/h2-15,38H,1H3,(H,36,37)/b23-13- |
| InChIKey | FYKXVGUTIZZJER-QRVIBDJDSA-N |
| XLogP | 6.24 |
| TPSA | 104.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.52 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|