C33H20F12O4 — CID 59898141
4-[2-[4-[[4-[2-(4-carboxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoic acid (PubChem CID 59898141) has the molecular formula C33H20F12O4 and a molecular weight of 708.50 g/mol. Its IUPAC name is 4-[2-[4-[[4-[2-(4-carboxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoic acid.
| Compound Name | 4-[2-[4-[[4-[2-(4-carboxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 59898141 |
| Molecular Formula | C33H20F12O4 |
| Molecular Weight | 708.50 g/mol |
| Exact Mass | 708.12 |
| IUPAC Name | 4-[2-[4-[[4-[2-(4-carboxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]methyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(c2ccc(Cc3ccc(C(c4ccc(C(=O)O)cc4)(C(F)(F)F)C(F)(F)F)cc3)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H20F12O4/c34-30(35,36)28(31(37,38)39,24-13-5-20(6-14-24)26(46)47)22-9-1-18(2-10-22)17-19-3-11-23(12-4-19)29(32(40,41)42,33(43,44)45)25-15-7-21(8-16-25)27(48)49/h1-16H,17H2,(H,46,47)(H,48,49) |
| InChIKey | CSCLAWFZUOWOIN-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.50 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |