C35H40N2O7 — CID 59899327
methyl 2-[(4-methoxyphenoxy)carbonyl-[(1S)-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]hexyl]amino]acetate (PubChem CID 59899327) has the molecular formula C35H40N2O7 and a molecular weight of 600.71 g/mol. Its IUPAC name is methyl 2-[(4-methoxyphenoxy)carbonyl-[(1S)-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]hexyl]amino]acetate.
| Compound Name | methyl 2-[(4-methoxyphenoxy)carbonyl-[(1S)-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]hexyl]amino]acetate |
|---|---|
| PubChem CID | 59899327 |
| Molecular Formula | C35H40N2O7 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | methyl 2-[(4-methoxyphenoxy)carbonyl-[(1S)-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]hexyl]amino]acetate |
| SMILES | CCCCC[C@@H](c1ccc(OCCc2nc(-c3ccccc3)oc2C)cc1)N(CC(=O)OC)C(=O)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C35H40N2O7/c1-5-6-8-13-32(37(24-33(38)41-4)35(39)44-30-20-18-28(40-3)19-21-30)26-14-16-29(17-15-26)42-23-22-31-25(2)43-34(36-31)27-11-9-7-10-12-27/h7,9-12,14-21,32H,5-6,8,13,22-24H2,1-4H3/t32-/m0/s1 |
| InChIKey | AOJBAYIWKBMAAQ-YTTGMZPUSA-N |
| XLogP | 7.58 |
| TPSA | 100.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|