C25H28N2O4 — CID 22087867
methyl 2-[1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]but-3-enylamino]acetate (PubChem CID 22087867) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is methyl 2-[1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]but-3-enylamino]acetate.
| Compound Name | methyl 2-[1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]but-3-enylamino]acetate |
|---|---|
| PubChem CID | 22087867 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | methyl 2-[1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]but-3-enylamino]acetate |
| SMILES | C=CCC(NCC(=O)OC)c1ccc(OCCc2nc(-c3ccccc3)oc2C)cc1 |
| InChI | InChI=1S/C25H28N2O4/c1-4-8-23(26-17-24(28)29-3)19-11-13-21(14-12-19)30-16-15-22-18(2)31-25(27-22)20-9-6-5-7-10-20/h4-7,9-14,23,26H,1,8,15-17H2,2-3H3 |
| InChIKey | RAXYBBWXEAWSRV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|