C29H29F3N2O4 — CID 89226116
2,2,2-trifluoro-N-[(1S)-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]but-3-enyl]-N-[(2S)-1-oxopent-4-en-2-yl]acetamide (PubChem CID 89226116) has the molecular formula C29H29F3N2O4 and a molecular weight of 526.56 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1S)-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]but-3-enyl]-N-[(2S)-1-oxopent-4-en-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1S)-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]but-3-enyl]-N-[(2S)-1-oxopent-4-en-2-yl]acetamide |
|---|---|
| PubChem CID | 89226116 |
| Molecular Formula | C29H29F3N2O4 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1S)-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]but-3-enyl]-N-[(2S)-1-oxopent-4-en-2-yl]acetamide |
| SMILES | C=CC[C@@H](C=O)N(C(=O)C(F)(F)F)[C@@H](CC=C)c1ccc(OCCc2nc(-c3ccccc3)oc2C)cc1 |
| InChI | InChI=1S/C29H29F3N2O4/c1-4-9-23(19-35)34(28(36)29(30,31)32)26(10-5-2)21-13-15-24(16-14-21)37-18-17-25-20(3)38-27(33-25)22-11-7-6-8-12-22/h4-8,11-16,19,23,26H,1-2,9-10,17-18H2,3H3/t23-,26-/m0/s1 |
| InChIKey | HTIZTVFFUZMOBT-OZXSUGGESA-N |
| XLogP | 6.42 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|