C32H29F3N2O5 — CID 70160213
3-[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]phenyl]-3-[[(E)-1,1,1-trifluoro-4-oxo-4-phenylbut-2-en-2-yl]amino]propanoic acid (PubChem CID 70160213) has the molecular formula C32H29F3N2O5 and a molecular weight of 578.59 g/mol. Its IUPAC name is 3-[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]phenyl]-3-[[(E)-1,1,1-trifluoro-4-oxo-4-phenylbut-2-en-2-yl]amino]propanoic acid.
| Compound Name | 3-[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]phenyl]-3-[[(E)-1,1,1-trifluoro-4-oxo-4-phenylbut-2-en-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 70160213 |
| Molecular Formula | C32H29F3N2O5 |
| Molecular Weight | 578.59 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | 3-[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]phenyl]-3-[[(E)-1,1,1-trifluoro-4-oxo-4-phenylbut-2-en-2-yl]amino]propanoic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1CCCOc1ccc(C(CC(=O)O)N/C(=C/C(=O)c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H29F3N2O5/c1-21-26(37-31(42-21)24-11-6-3-7-12-24)13-8-18-41-25-16-14-22(15-17-25)27(19-30(39)40)36-29(32(33,34)35)20-28(38)23-9-4-2-5-10-23/h2-7,9-12,14-17,20,27,36H,8,13,18-19H2,1H3,(H,39,40)/b29-20+ |
| InChIKey | PZFHNLCVDLLHTI-ZTKZIYFRSA-N |
| XLogP | 7.10 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.59 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|