C32H32N2O4 — CID 126700942
(Z)-3-[[(2S)-3-hydroxy-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]but-3-en-2-yl]amino]-1-phenylbut-2-en-1-one (PubChem CID 126700942) has the molecular formula C32H32N2O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is (Z)-3-[[(2S)-3-hydroxy-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]but-3-en-2-yl]amino]-1-phenylbut-2-en-1-one.
| Compound Name | (Z)-3-[[(2S)-3-hydroxy-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]but-3-en-2-yl]amino]-1-phenylbut-2-en-1-one |
|---|---|
| PubChem CID | 126700942 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | (Z)-3-[[(2S)-3-hydroxy-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]but-3-en-2-yl]amino]-1-phenylbut-2-en-1-one |
| SMILES | C=C(O)[C@H](Cc1ccc(OCCc2nc(-c3ccccc3)oc2C)cc1)N/C(C)=C\C(=O)c1ccccc1 |
| InChI | InChI=1S/C32H32N2O4/c1-22(20-31(36)26-10-6-4-7-11-26)33-30(23(2)35)21-25-14-16-28(17-15-25)37-19-18-29-24(3)38-32(34-29)27-12-8-5-9-13-27/h4-17,20,30,33,35H,2,18-19,21H2,1,3H3/b22-20-/t30-/m0/s1 |
| InChIKey | RIZRUIANCNYSCE-KRFKBLHGSA-N |
| XLogP | 6.63 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|