C22H19NO5S — CID 59899967
(E)-3-[[4-(3-carbamoyl-4-hydroxynaphthalen-1-yl)oxy-3-methylphenyl]methylsulfanyl]prop-2-enoic acid (PubChem CID 59899967) has the molecular formula C22H19NO5S and a molecular weight of 409.46 g/mol. Its IUPAC name is (E)-3-[[4-(3-carbamoyl-4-hydroxynaphthalen-1-yl)oxy-3-methylphenyl]methylsulfanyl]prop-2-enoic acid.
| Compound Name | (E)-3-[[4-(3-carbamoyl-4-hydroxynaphthalen-1-yl)oxy-3-methylphenyl]methylsulfanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59899967 |
| Molecular Formula | C22H19NO5S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (E)-3-[[4-(3-carbamoyl-4-hydroxynaphthalen-1-yl)oxy-3-methylphenyl]methylsulfanyl]prop-2-enoic acid |
| SMILES | Cc1cc(CS/C=C/C(=O)O)ccc1Oc1cc(C(N)=O)c(O)c2ccccc12 |
| InChI | InChI=1S/C22H19NO5S/c1-13-10-14(12-29-9-8-20(24)25)6-7-18(13)28-19-11-17(22(23)27)21(26)16-5-3-2-4-15(16)19/h2-11,26H,12H2,1H3,(H2,23,27)(H,24,25)/b9-8+ |
| InChIKey | VUKHEYSHHXSJRC-CMDGGOBGSA-N |
| XLogP | 4.58 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|