C27H33F2N5O2S — CID 59900397
6-[2-[(3,4-difluorophenyl)methylsulfanyl]-4-oxo-5-(pyrimidin-5-ylmethyl)pyrimidin-1-yl]-N-pentylhexanamide (PubChem CID 59900397) has the molecular formula C27H33F2N5O2S and a molecular weight of 529.66 g/mol. Its IUPAC name is 6-[2-[(3,4-difluorophenyl)methylsulfanyl]-4-oxo-5-(pyrimidin-5-ylmethyl)pyrimidin-1-yl]-N-pentylhexanamide.
| Compound Name | 6-[2-[(3,4-difluorophenyl)methylsulfanyl]-4-oxo-5-(pyrimidin-5-ylmethyl)pyrimidin-1-yl]-N-pentylhexanamide |
|---|---|
| PubChem CID | 59900397 |
| Molecular Formula | C27H33F2N5O2S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 6-[2-[(3,4-difluorophenyl)methylsulfanyl]-4-oxo-5-(pyrimidin-5-ylmethyl)pyrimidin-1-yl]-N-pentylhexanamide |
| SMILES | CCCCCNC(=O)CCCCCn1cc(Cc2cncnc2)c(=O)nc1SCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C27H33F2N5O2S/c1-2-3-6-11-32-25(35)8-5-4-7-12-34-17-22(13-21-15-30-19-31-16-21)26(36)33-27(34)37-18-20-9-10-23(28)24(29)14-20/h9-10,14-17,19H,2-8,11-13,18H2,1H3,(H,32,35) |
| InChIKey | ITHWBGXSKUOMHA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|