C22H20NO2Y- — CID 59902849
2-(3-methanidylidene-2-methylinden-1-yl)-2-oxo-N-(2-phenylpropan-2-yl)acetamide;yttrium (PubChem CID 59902849) has the molecular formula C22H20NO2Y- and a molecular weight of 419.31 g/mol. Its IUPAC name is 2-(3-methanidylidene-2-methylinden-1-yl)-2-oxo-N-(2-phenylpropan-2-yl)acetamide;yttrium.
| Compound Name | 2-(3-methanidylidene-2-methylinden-1-yl)-2-oxo-N-(2-phenylpropan-2-yl)acetamide;yttrium |
|---|---|
| PubChem CID | 59902849 |
| Molecular Formula | C22H20NO2Y- |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 2-(3-methanidylidene-2-methylinden-1-yl)-2-oxo-N-(2-phenylpropan-2-yl)acetamide;yttrium |
| SMILES | [H]/[C-]=C1\C(C)=C(C(=O)C(=O)NC(C)(C)c2ccccc2)c2ccccc21.[Y] |
| InChI | InChI=1S/C22H20NO2.Y/c1-14-15(2)19(18-13-9-8-12-17(14)18)20(24)21(25)23-22(3,4)16-10-6-5-7-11-16;/h1,5-13H,2-4H3,(H,23,25);/q-1; |
| InChIKey | ARGHTAJJDZHIHI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|