C14H19NO4S2 — CID 59903361
ethyl (3S)-2-thiophen-2-ylsulfonyl-2-azabicyclo[2.2.2]octane-3-carboxylate (PubChem CID 59903361) has the molecular formula C14H19NO4S2 and a molecular weight of 329.44 g/mol. Its IUPAC name is ethyl (3S)-2-thiophen-2-ylsulfonyl-2-azabicyclo[2.2.2]octane-3-carboxylate.
| Compound Name | ethyl (3S)-2-thiophen-2-ylsulfonyl-2-azabicyclo[2.2.2]octane-3-carboxylate |
|---|---|
| PubChem CID | 59903361 |
| Molecular Formula | C14H19NO4S2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | ethyl (3S)-2-thiophen-2-ylsulfonyl-2-azabicyclo[2.2.2]octane-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C2CCC(CC2)N1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H19NO4S2/c1-2-19-14(16)13-10-5-7-11(8-6-10)15(13)21(17,18)12-4-3-9-20-12/h3-4,9-11,13H,2,5-8H2,1H3/t10?,11?,13-/m0/s1 |
| InChIKey | DLZGJLUHGKISMT-XIVSLSHWSA-N |
| XLogP | 2.24 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |