About acetyl-(4-oxocyclohexa-2,5-dien-1-ylidene)azanium
acetyl-(4-oxocyclohexa-2,5-dien-1-ylidene)azanium (PubChem CID 59903929) has the molecular formula C8H8NO2+
and a molecular weight of 150.16 g/mol. Its IUPAC name is acetyl-(4-oxocyclohexa-2,5-dien-1-ylidene)azanium.
Molecular Properties
| Compound Name | acetyl-(4-oxocyclohexa-2,5-dien-1-ylidene)azanium |
| PubChem CID | 59903929 |
| Molecular Formula | C8H8NO2+ |
| Molecular Weight | 150.16 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | acetyl-(4-oxocyclohexa-2,5-dien-1-ylidene)azanium |
| SMILES | CC(=O)[NH+]=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C8H7NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5H,1H3/p+1 |
| InChIKey | URNSECGXFRDEDC-UHFFFAOYSA-O |
| XLogP | -1.25 |
| TPSA | 48.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.16 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze acetyl-(4-oxocyclohexa-2,5-dien-1-ylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl-(4-oxocyclohexa-2,5-dien-1-ylidene)azanium?
The IUPAC name of acetyl-(4-oxocyclohexa-2,5-dien-1-ylidene)azanium (CID 59903929) is acetyl-(4-oxocyclohexa-2,5-dien-1-ylidene)azanium.
What is the SMILES notation for acetyl-(4-oxocyclohexa-2,5-dien-1-ylidene)azanium?
The canonical SMILES for acetyl-(4-oxocyclohexa-2,5-dien-1-ylidene)azanium is CC(=O)[NH+]=C1C=CC(=O)C=C1.
What is the InChIKey of acetyl-(4-oxocyclohexa-2,5-dien-1-ylidene)azanium?
The InChIKey is URNSECGXFRDEDC-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H7NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5H,1H3/p+1.
What are the key properties of acetyl-(4-oxocyclohexa-2,5-dien-1-ylidene)azanium?
acetyl-(4-oxocyclohexa-2,5-dien-1-ylidene)azanium has a molecular weight of 150.16 g/mol, XLogP of -1.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl-(4-oxocyclohexa-2,5-dien-1-ylidene)azanium is sourced from PubChem (CID 59903929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).