C12H23N3O4S2 — CID 59904850
S-[(3S,5S)-5-[2-(dimethylsulfamoyl)ethylcarbamoyl]-1-methylpyrrolidin-3-yl] ethanethioate (PubChem CID 59904850) has the molecular formula C12H23N3O4S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is S-[(3S,5S)-5-[2-(dimethylsulfamoyl)ethylcarbamoyl]-1-methylpyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[(3S,5S)-5-[2-(dimethylsulfamoyl)ethylcarbamoyl]-1-methylpyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 59904850 |
| Molecular Formula | C12H23N3O4S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | S-[(3S,5S)-5-[2-(dimethylsulfamoyl)ethylcarbamoyl]-1-methylpyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)S[C@H]1C[C@@H](C(=O)NCCS(=O)(=O)N(C)C)N(C)C1 |
| InChI | InChI=1S/C12H23N3O4S2/c1-9(16)20-10-7-11(15(4)8-10)12(17)13-5-6-21(18,19)14(2)3/h10-11H,5-8H2,1-4H3,(H,13,17)/t10-,11-/m0/s1 |
| InChIKey | NNDCKHLQIBSIEU-QWRGUYRKSA-N |
| XLogP | -0.65 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|