C23H34N2O7 — CID 59907088
methyl (2S,4R)-1-[(2S)-2-[(3-hydroxybenzoyl)amino]-3,3-dimethylbutanoyl]-4-(4-hydroxybutoxy)pyrrolidine-2-carboxylate (PubChem CID 59907088) has the molecular formula C23H34N2O7 and a molecular weight of 450.53 g/mol. Its IUPAC name is methyl (2S,4R)-1-[(2S)-2-[(3-hydroxybenzoyl)amino]-3,3-dimethylbutanoyl]-4-(4-hydroxybutoxy)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-1-[(2S)-2-[(3-hydroxybenzoyl)amino]-3,3-dimethylbutanoyl]-4-(4-hydroxybutoxy)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 59907088 |
| Molecular Formula | C23H34N2O7 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | methyl (2S,4R)-1-[(2S)-2-[(3-hydroxybenzoyl)amino]-3,3-dimethylbutanoyl]-4-(4-hydroxybutoxy)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](OCCCCO)CN1C(=O)[C@@H](NC(=O)c1cccc(O)c1)C(C)(C)C |
| InChI | InChI=1S/C23H34N2O7/c1-23(2,3)19(24-20(28)15-8-7-9-16(27)12-15)21(29)25-14-17(32-11-6-5-10-26)13-18(25)22(30)31-4/h7-9,12,17-19,26-27H,5-6,10-11,13-14H2,1-4H3,(H,24,28)/t17-,18+,19-/m1/s1 |
| InChIKey | XQNFKGZSQPCTQV-CEXWTWQISA-N |
| XLogP | 1.47 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|