C25H34IN3O6S — CID 59907093
methyl (2S,4R)-1-[(2S)-2-cyclohexyl-2-(pent-4-enoylamino)acetyl]-4-[(4-iodophenyl)sulfonylamino]pyrrolidine-2-carboxylate (PubChem CID 59907093) has the molecular formula C25H34IN3O6S and a molecular weight of 631.53 g/mol. Its IUPAC name is methyl (2S,4R)-1-[(2S)-2-cyclohexyl-2-(pent-4-enoylamino)acetyl]-4-[(4-iodophenyl)sulfonylamino]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-1-[(2S)-2-cyclohexyl-2-(pent-4-enoylamino)acetyl]-4-[(4-iodophenyl)sulfonylamino]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 59907093 |
| Molecular Formula | C25H34IN3O6S |
| Molecular Weight | 631.53 g/mol |
| Exact Mass | 631.12 |
| IUPAC Name | methyl (2S,4R)-1-[(2S)-2-cyclohexyl-2-(pent-4-enoylamino)acetyl]-4-[(4-iodophenyl)sulfonylamino]pyrrolidine-2-carboxylate |
| SMILES | C=CCCC(=O)N[C@H](C(=O)N1C[C@H](NS(=O)(=O)c2ccc(I)cc2)C[C@H]1C(=O)OC)C1CCCCC1 |
| InChI | InChI=1S/C25H34IN3O6S/c1-3-4-10-22(30)27-23(17-8-6-5-7-9-17)24(31)29-16-19(15-21(29)25(32)35-2)28-36(33,34)20-13-11-18(26)12-14-20/h3,11-14,17,19,21,23,28H,1,4-10,15-16H2,2H3,(H,27,30)/t19-,21+,23+/m1/s1 |
| InChIKey | IVHWHYHWPUNBQY-NWSQWKLXSA-N |
| XLogP | 2.74 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|