C26H38N2O6 — CID 11612584
methyl (3S)-2-[(2S)-2-cyclohexyl-2-(7-hydroxyheptanoylamino)acetyl]-7-hydroxy-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 11612584) has the molecular formula C26H38N2O6 and a molecular weight of 474.60 g/mol. Its IUPAC name is methyl (3S)-2-[(2S)-2-cyclohexyl-2-(7-hydroxyheptanoylamino)acetyl]-7-hydroxy-3,4-dihydro-1H-isoquinoline-3-carboxylate.
| Compound Name | methyl (3S)-2-[(2S)-2-cyclohexyl-2-(7-hydroxyheptanoylamino)acetyl]-7-hydroxy-3,4-dihydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 11612584 |
| Molecular Formula | C26H38N2O6 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | methyl (3S)-2-[(2S)-2-cyclohexyl-2-(7-hydroxyheptanoylamino)acetyl]-7-hydroxy-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2ccc(O)cc2CN1C(=O)[C@@H](NC(=O)CCCCCCO)C1CCCCC1 |
| InChI | InChI=1S/C26H38N2O6/c1-34-26(33)22-16-19-12-13-21(30)15-20(19)17-28(22)25(32)24(18-9-5-4-6-10-18)27-23(31)11-7-2-3-8-14-29/h12-13,15,18,22,24,29-30H,2-11,14,16-17H2,1H3,(H,27,31)/t22-,24-/m0/s1 |
| InChIKey | JWEGZXYHNLNSIF-UPVQGACJSA-N |
| XLogP | 2.83 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|