C11H20O2 — CID 59911112
(2S)-2-[(3R)-5,5-dimethyloxolan-3-yl]pent-4-en-2-ol (PubChem CID 59911112) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (2S)-2-[(3R)-5,5-dimethyloxolan-3-yl]pent-4-en-2-ol.
| Compound Name | (2S)-2-[(3R)-5,5-dimethyloxolan-3-yl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 59911112 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (2S)-2-[(3R)-5,5-dimethyloxolan-3-yl]pent-4-en-2-ol |
| SMILES | C=CC[C@](C)(O)[C@H]1COC(C)(C)C1 |
| InChI | InChI=1S/C11H20O2/c1-5-6-11(4,12)9-7-10(2,3)13-8-9/h5,9,12H,1,6-8H2,2-4H3/t9-,11+/m1/s1 |
| InChIKey | BSJMNPDLVSMVHA-KOLCDFICSA-N |
| XLogP | 2.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|