C13H22O2 — CID 59912158
(E)-1-[(2S)-3-tert-butyloxiran-2-yl]-4,4-dimethylpent-1-en-3-one (PubChem CID 59912158) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (E)-1-[(2S)-3-tert-butyloxiran-2-yl]-4,4-dimethylpent-1-en-3-one.
| Compound Name | (E)-1-[(2S)-3-tert-butyloxiran-2-yl]-4,4-dimethylpent-1-en-3-one |
|---|---|
| PubChem CID | 59912158 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (E)-1-[(2S)-3-tert-butyloxiran-2-yl]-4,4-dimethylpent-1-en-3-one |
| SMILES | CC(C)(C)C(=O)/C=C/[C@@H]1OC1C(C)(C)C |
| InChI | InChI=1S/C13H22O2/c1-12(2,3)10(14)8-7-9-11(15-9)13(4,5)6/h7-9,11H,1-6H3/b8-7+/t9-,11?/m0/s1 |
| InChIKey | GSDYJYOQAHEYHZ-VCMSZYDCSA-N |
| XLogP | 2.97 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|