C5H10O — CID 59913029
(2S,3R)-2,3-dimethyloxetane (PubChem CID 59913029) has the molecular formula C5H10O and a molecular weight of 86.13 g/mol. Its IUPAC name is (2S,3R)-2,3-dimethyloxetane.
| Compound Name | (2S,3R)-2,3-dimethyloxetane |
|---|---|
| PubChem CID | 59913029 |
| Molecular Formula | C5H10O |
| Molecular Weight | 86.13 g/mol |
| Exact Mass | 86.07 |
| IUPAC Name | (2S,3R)-2,3-dimethyloxetane |
| SMILES | C[C@@H]1CO[C@H]1C |
| InChI | InChI=1S/C5H10O/c1-4-3-6-5(4)2/h4-5H,3H2,1-2H3/t4-,5+/m1/s1 |
| InChIKey | CIPFOSRMMVMZPR-UHNVWZDZSA-N |
| XLogP | 1.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 86.13 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |