C19H36NO7PW2-2 — CID 59914594
[(1R,3S,5R)-2-amino-3-methyl-5-propan-2-yloxycyclopentyl]methyl [(2R,3R,5S)-5-methyl-2-(propan-2-yloxymethyl)-2,3,4,5-tetrahydrofuran-4-id-3-yl] phosphate;tungsten (PubChem CID 59914594) has the molecular formula C19H36NO7PW2-2 and a molecular weight of 789.15 g/mol. Its IUPAC name is [(1R,3S,5R)-2-amino-3-methyl-5-propan-2-yloxycyclopentyl]methyl [(2R,3R,5S)-5-methyl-2-(propan-2-yloxymethyl)-2,3,4,5-tetrahydrofuran-4-id-3-yl] phosphate;tungsten.
| Compound Name | [(1R,3S,5R)-2-amino-3-methyl-5-propan-2-yloxycyclopentyl]methyl [(2R,3R,5S)-5-methyl-2-(propan-2-yloxymethyl)-2,3,4,5-tetrahydrofuran-4-id-3-yl] phosphate;tungsten |
|---|---|
| PubChem CID | 59914594 |
| Molecular Formula | C19H36NO7PW2-2 |
| Molecular Weight | 789.15 g/mol |
| Exact Mass | 789.13 |
| IUPAC Name | [(1R,3S,5R)-2-amino-3-methyl-5-propan-2-yloxycyclopentyl]methyl [(2R,3R,5S)-5-methyl-2-(propan-2-yloxymethyl)-2,3,4,5-tetrahydrofuran-4-id-3-yl] phosphate;tungsten |
| SMILES | CC(C)OC[C@H]1O[C@@H](C)[CH-][C@H]1OP(=O)([O-])OC[C@H]1C(N)[C@@H](C)C[C@H]1OC(C)C.[W].[W] |
| InChI | InChI=1S/C19H37NO7P.2W/c1-11(2)23-10-18-17(8-14(6)26-18)27-28(21,22)24-9-15-16(25-12(3)4)7-13(5)19(15)20;;/h8,11-19H,7,9-10,20H2,1-6H3,(H,21,22);;/q-1;;/p-1/t13-,14-,15+,16+,17+,18+,19?;;/m0../s1 |
| InChIKey | CQANARGSFIORNK-DGLHSWMHSA-M |
| XLogP | 2.05 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.15 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|