C27H40O3 — CID 59915708
[(6Z,9Z,12Z)-4-oxopentadeca-6,9,12-trienyl] (3Z,6Z,9Z)-dodeca-3,6,9-trienoate (PubChem CID 59915708) has the molecular formula C27H40O3 and a molecular weight of 412.61 g/mol. Its IUPAC name is [(6Z,9Z,12Z)-4-oxopentadeca-6,9,12-trienyl] (3Z,6Z,9Z)-dodeca-3,6,9-trienoate.
| Compound Name | [(6Z,9Z,12Z)-4-oxopentadeca-6,9,12-trienyl] (3Z,6Z,9Z)-dodeca-3,6,9-trienoate |
|---|---|
| PubChem CID | 59915708 |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | [(6Z,9Z,12Z)-4-oxopentadeca-6,9,12-trienyl] (3Z,6Z,9Z)-dodeca-3,6,9-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CC(=O)CCCOC(=O)C/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C27H40O3/c1-3-5-7-9-11-13-15-17-19-22-26(28)23-21-25-30-27(29)24-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20H,3-4,9-10,15-16,21-25H2,1-2H3/b7-5-,8-6-,13-11-,14-12-,19-17-,20-18- |
| InChIKey | XFFHPALUFPLQDO-YTWBPVBXSA-N |
| XLogP | 7.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|