C20H25BrN4O3 — CID 59918323
N-(2-acetamidoethyl)-5-[(Z)-[(4Z,5E)-4-(2-bromoethylidene)-5-ethylidene-2-oxopyrrolidin-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 59918323) has the molecular formula C20H25BrN4O3 and a molecular weight of 449.35 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-5-[(Z)-[(4Z,5E)-4-(2-bromoethylidene)-5-ethylidene-2-oxopyrrolidin-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-5-[(Z)-[(4Z,5E)-4-(2-bromoethylidene)-5-ethylidene-2-oxopyrrolidin-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59918323 |
| Molecular Formula | C20H25BrN4O3 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-(2-acetamidoethyl)-5-[(Z)-[(4Z,5E)-4-(2-bromoethylidene)-5-ethylidene-2-oxopyrrolidin-3-ylidene]methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | C/C=C1/NC(=O)C(=C\c2[nH]c(C)c(C(=O)NCCNC(C)=O)c2C)/C1=C/CBr |
| InChI | InChI=1S/C20H25BrN4O3/c1-5-16-14(6-7-21)15(19(27)25-16)10-17-11(2)18(12(3)24-17)20(28)23-9-8-22-13(4)26/h5-6,10,24H,7-9H2,1-4H3,(H,22,26)(H,23,28)(H,25,27)/b14-6-,15-10-,16-5+ |
| InChIKey | YAFXUTFZTWUEAT-ROUALUODSA-N |
| XLogP | 2.24 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|