C25H34N4O2S — CID 59078862
(3Z,4Z,5E)-4-[2-[(E)-but-2-enyl]sulfanylethylidene]-3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-5-ethylidenepyrrolidin-2-one (PubChem CID 59078862) has the molecular formula C25H34N4O2S and a molecular weight of 454.64 g/mol. Its IUPAC name is (3Z,4Z,5E)-4-[2-[(E)-but-2-enyl]sulfanylethylidene]-3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-5-ethylidenepyrrolidin-2-one.
| Compound Name | (3Z,4Z,5E)-4-[2-[(E)-but-2-enyl]sulfanylethylidene]-3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-5-ethylidenepyrrolidin-2-one |
|---|---|
| PubChem CID | 59078862 |
| Molecular Formula | C25H34N4O2S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | (3Z,4Z,5E)-4-[2-[(E)-but-2-enyl]sulfanylethylidene]-3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-5-ethylidenepyrrolidin-2-one |
| SMILES | C/C=C/CSC/C=C1/C(=C/c2[nH]c(C)c(C(=O)N3CCN(C)CC3)c2C)/C(=O)N/C1=C/C |
| InChI | InChI=1S/C25H34N4O2S/c1-6-8-14-32-15-9-19-20(24(30)27-21(19)7-2)16-22-17(3)23(18(4)26-22)25(31)29-12-10-28(5)11-13-29/h6-9,16,26H,10-15H2,1-5H3,(H,27,30)/b8-6+,19-9-,20-16-,21-7+ |
| InChIKey | LZJGQWNSSXYKCL-YJKMTXSNSA-N |
| XLogP | 3.67 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|