C28H29N5O6S — CID 85337935
3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-5-[(4-nitrophenyl)methylsulfonyl]-1H-indol-2-one (PubChem CID 85337935) has the molecular formula C28H29N5O6S and a molecular weight of 563.64 g/mol. Its IUPAC name is 3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-5-[(4-nitrophenyl)methylsulfonyl]-1H-indol-2-one.
| Compound Name | 3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-5-[(4-nitrophenyl)methylsulfonyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 85337935 |
| Molecular Formula | C28H29N5O6S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | 3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-5-[(4-nitrophenyl)methylsulfonyl]-1H-indol-2-one |
| SMILES | Cc1[nH]c(C=C2C(=O)Nc3ccc(S(=O)(=O)Cc4ccc([N+](=O)[O-])cc4)cc32)c(C)c1C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C28H29N5O6S/c1-17-25(29-18(2)26(17)28(35)32-12-10-31(3)11-13-32)15-23-22-14-21(8-9-24(22)30-27(23)34)40(38,39)16-19-4-6-20(7-5-19)33(36)37/h4-9,14-15,29H,10-13,16H2,1-3H3,(H,30,34) |
| InChIKey | DDFBWSUQDRNPEM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 145.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|