C28H29IN4O4S — CID 91207759
3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-5-[(2-iodophenyl)methylsulfonyl]-1H-indol-2-one (PubChem CID 91207759) has the molecular formula C28H29IN4O4S and a molecular weight of 644.54 g/mol. Its IUPAC name is 3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-5-[(2-iodophenyl)methylsulfonyl]-1H-indol-2-one.
| Compound Name | 3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-5-[(2-iodophenyl)methylsulfonyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 91207759 |
| Molecular Formula | C28H29IN4O4S |
| Molecular Weight | 644.54 g/mol |
| Exact Mass | 644.10 |
| IUPAC Name | 3-[[3,5-dimethyl-4-(4-methylpiperazine-1-carbonyl)-1H-pyrrol-2-yl]methylidene]-5-[(2-iodophenyl)methylsulfonyl]-1H-indol-2-one |
| SMILES | Cc1[nH]c(C=C2C(=O)Nc3ccc(S(=O)(=O)Cc4ccccc4I)cc32)c(C)c1C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C28H29IN4O4S/c1-17-25(30-18(2)26(17)28(35)33-12-10-32(3)11-13-33)15-22-21-14-20(8-9-24(21)31-27(22)34)38(36,37)16-19-6-4-5-7-23(19)29/h4-9,14-15,30H,10-13,16H2,1-3H3,(H,31,34) |
| InChIKey | OHFZEBAMVGSHEK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|