C24H41N3O4 — CID 59918929
tert-butyl (3S)-3-[cyclohexyl(cyclohexylcarbamoyl)carbamoyl]piperidine-1-carboxylate (PubChem CID 59918929) has the molecular formula C24H41N3O4 and a molecular weight of 435.61 g/mol. Its IUPAC name is tert-butyl (3S)-3-[cyclohexyl(cyclohexylcarbamoyl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[cyclohexyl(cyclohexylcarbamoyl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59918929 |
| Molecular Formula | C24H41N3O4 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | tert-butyl (3S)-3-[cyclohexyl(cyclohexylcarbamoyl)carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C(=O)N(C(=O)NC2CCCCC2)C2CCCCC2)C1 |
| InChI | InChI=1S/C24H41N3O4/c1-24(2,3)31-23(30)26-16-10-11-18(17-26)21(28)27(20-14-8-5-9-15-20)22(29)25-19-12-6-4-7-13-19/h18-20H,4-17H2,1-3H3,(H,25,29)/t18-/m0/s1 |
| InChIKey | OUVLWZDQHTWJOQ-SFHVURJKSA-N |
| XLogP | 4.84 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |