C17H21NO4 — CID 59920105
(3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octan-2-yl)methyl-(oxomethyl)oxidanium (PubChem CID 59920105) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is (3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octan-2-yl)methyl-(oxomethyl)oxidanium.
| Compound Name | (3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octan-2-yl)methyl-(oxomethyl)oxidanium |
|---|---|
| PubChem CID | 59920105 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octan-2-yl)methyl-(oxomethyl)oxidanium |
| SMILES | CN1C2CCC1C(C[OH+][C-]=O)C(OC(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C17H21NO4/c1-18-13-7-8-15(18)14(10-21-11-19)16(9-13)22-17(20)12-5-3-2-4-6-12/h2-6,13-16,21H,7-10H2,1H3 |
| InChIKey | DGPDGFUWVGTWIN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 59.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|