C13H14BNO3 — CID 59921434
methoxy-[4-(methoxymethoxy)naphthalen-2-yl]iminoborane (PubChem CID 59921434) has the molecular formula C13H14BNO3 and a molecular weight of 243.07 g/mol. Its IUPAC name is methoxy-[4-(methoxymethoxy)naphthalen-2-yl]iminoborane.
| Compound Name | methoxy-[4-(methoxymethoxy)naphthalen-2-yl]iminoborane |
|---|---|
| PubChem CID | 59921434 |
| Molecular Formula | C13H14BNO3 |
| Molecular Weight | 243.07 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | methoxy-[4-(methoxymethoxy)naphthalen-2-yl]iminoborane |
| SMILES | CO/B=N/c1cc(OCOC)c2ccccc2c1 |
| InChI | InChI=1S/C13H14BNO3/c1-16-9-18-13-8-11(15-14-17-2)7-10-5-3-4-6-12(10)13/h3-8H,9H2,1-2H3 |
| InChIKey | HUIXLQPZUBRFRE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.07 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|