C11H14N4O2 — CID 59922816
3-ethyl-4-[(3-ethyl-5-oxo-1,2-dihydropyrazol-4-yl)methylidene]-1H-pyrazol-5-one (PubChem CID 59922816) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 3-ethyl-4-[(3-ethyl-5-oxo-1,2-dihydropyrazol-4-yl)methylidene]-1H-pyrazol-5-one.
| Compound Name | 3-ethyl-4-[(3-ethyl-5-oxo-1,2-dihydropyrazol-4-yl)methylidene]-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 59922816 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 3-ethyl-4-[(3-ethyl-5-oxo-1,2-dihydropyrazol-4-yl)methylidene]-1H-pyrazol-5-one |
| SMILES | CCC1=NNC(=O)C1=Cc1c(CC)[nH][nH]c1=O |
| InChI | InChI=1S/C11H14N4O2/c1-3-8-6(10(16)14-12-8)5-7-9(4-2)13-15-11(7)17/h5H,3-4H2,1-2H3,(H,14,16)(H2,13,15,17) |
| InChIKey | PLEDDAQIWUXSSC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|