C21H33N3O5 — CID 59923013
tert-butyl (4R)-2,2-dimethyl-4-[(Z)-4-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]oxadiazolo[4,3-a]azepin-5-yl)but-1-enyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 59923013) has the molecular formula C21H33N3O5 and a molecular weight of 407.51 g/mol. Its IUPAC name is tert-butyl (4R)-2,2-dimethyl-4-[(Z)-4-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]oxadiazolo[4,3-a]azepin-5-yl)but-1-enyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2-dimethyl-4-[(Z)-4-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]oxadiazolo[4,3-a]azepin-5-yl)but-1-enyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 59923013 |
| Molecular Formula | C21H33N3O5 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | tert-butyl (4R)-2,2-dimethyl-4-[(Z)-4-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]oxadiazolo[4,3-a]azepin-5-yl)but-1-enyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](/C=C\CCC2CCCCc3noc(=O)n32)COC1(C)C |
| InChI | InChI=1S/C21H33N3O5/c1-20(2,3)28-19(26)24-16(14-27-21(24,4)5)12-7-6-10-15-11-8-9-13-17-22-29-18(25)23(15)17/h7,12,15-16H,6,8-11,13-14H2,1-5H3/b12-7-/t15?,16-/m1/s1 |
| InChIKey | HNEADHQCMIQFDC-XWXQTEEPSA-N |
| XLogP | 3.81 |
| TPSA | 86.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|