C21H37N3O3S — CID 59923464
S-[2-[2-cyclohexylethyl-[[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]carbamoyl]amino]ethyl] ethanethioate (PubChem CID 59923464) has the molecular formula C21H37N3O3S and a molecular weight of 411.61 g/mol. Its IUPAC name is S-[2-[2-cyclohexylethyl-[[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]carbamoyl]amino]ethyl] ethanethioate.
| Compound Name | S-[2-[2-cyclohexylethyl-[[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]carbamoyl]amino]ethyl] ethanethioate |
|---|---|
| PubChem CID | 59923464 |
| Molecular Formula | C21H37N3O3S |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | S-[2-[2-cyclohexylethyl-[[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]carbamoyl]amino]ethyl] ethanethioate |
| SMILES | CC(=O)SCCN(CCC1CCCCC1)C(=O)N[C@@H](C)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H37N3O3S/c1-17(20(26)23-12-7-4-8-13-23)22-21(27)24(15-16-28-18(2)25)14-11-19-9-5-3-6-10-19/h17,19H,3-16H2,1-2H3,(H,22,27)/t17-/m0/s1 |
| InChIKey | FLOVCVBLTDPXKP-KRWDZBQOSA-N |
| XLogP | 3.65 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|